Identifikatoren & physikalische Daten
| CAS No. | 14838-15-4 |
|---|
| Summenformel | C9H13NO |
|---|
| Durchschnittliche Molmasse | 151,21 g/mol |
|---|
| Monoisotopische Masse | 151,09971404 g/mol |
|---|
| SMILES | C[C@@H](N)[C@@H](O)c1ccccc1 |
|---|
| InChIKey | DLNKOYKMWOXYQA-VXNVDRBHSA-N |
|---|
| PubChem CID | 26934 |
|---|
| ChEMBL | CHEMBL2092846 |
|---|
| ChEBI | CHEBI:36 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 0,8 |
|---|
| Polarare Oberfläche (TPSA) | 46,3 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 11 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 110 |
|---|
| Löslichkeit | 733 mg/mL |
|---|
| Schmelzpunkt | 194 °C |
|---|
| Physical Description | Solid |
|---|
| Dissociation Constants | 9.05 |
|---|
| Collision Cross Section | 127.56 Ų [M+H-H2O]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards]127.8 Ų [M+H-H2O]+ [CCS Type: TW |
|---|
