HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2732607Erstellt: 3. November 2026
Alpha-morpholino-N-phenylsuccinimide
ALPHA-MORPHOLINO-N-PHENYLSUCCINIMIDE · 2,5-Pyrrolidinedione, 3-(4-morpholinyl)-1-phenyl-
https://huagongshe.com/de/chemical/2732607
Identifikatoren & physikalische Daten
| CAS No. | 53541-45-0 |
|---|
| Summenformel | C14H16N2O3 |
|---|
| Durchschnittliche Molmasse | 260,29 g/mol |
|---|
| Monoisotopische Masse | 260,11609238 g/mol |
|---|
| SMILES | O=C1CC(N2CCOCC2)C(=O)N1c1ccccc1 |
|---|
| InChIKey | RSWJDTMHFVKAAO-UHFFFAOYSA-N |
|---|
| PubChem CID | 2732607 |
|---|
| EC No. | 666-059-5 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 0,5 |
|---|
| Polarare Oberfläche (TPSA) | 49,9 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 360 |
|---|
| Schmelzpunkt | 155-157 °C(Solv: dichloromethane (75-09-2)hexane (110-54-3)) |
|---|
| Siedepunkt | 484.7±40.0 °C(Predicted) |
|---|
| Dichte | 1.306±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 4.69±0.20(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
