Identifikatoren & physikalische Daten
| CAS No. | 89143-27-1 |
|---|
| Summenformel | C16H20N2O3 |
|---|
| Durchschnittliche Molmasse | 288,34 g/mol |
|---|
| Monoisotopische Masse | 288,1473925 g/mol |
|---|
| SMILES | COc1ccc(N2C(=O)CC(N3CCCCC3)C2=O)cc1 |
|---|
| InChIKey | FGHXHGXNKZPYCG-UHFFFAOYSA-N |
|---|
| PubChem CID | 2732613 |
|---|
| ChEMBL | CHEMBL1574761 |
|---|
| DTXSID | DTXSID70369732 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|
| Polarare Oberfläche (TPSA) | 49,9 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 398 |
|---|
| Löslichkeit | >43.3 [ug/mL] (The mean of the results at pH 7.4) |
|---|
