HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-(2-Fluorophenyl)ethan-1-ol
2-Fluorobenzeneethanol · 2-(2-fluorophenyl)ethanol · 2-(O-FLUOROPHENYL)ETHANOL · Benzeneethanol, 2-fluoro- · 2-Fluorophenethyl alcohol · 2-fluoro-2-phenylethan-1-ol · 2-(2-Fluorophenyl)ethan-1-ol · 2-(2-Fluorophenyl)ethanol>2-Fluorophenethyl alcohol,99%
Identifikatoren & physikalische Daten
| CAS No. | 50919-06-7 |
|---|---|
| Summenformel | C8H9FO |
| Durchschnittliche Molmasse | 140,15 g/mol |
| Monoisotopische Masse | 140,06374313 g/mol |
| SMILES | OCCc1ccccc1F |
| InChIKey | HNIGZVZDWCTFPR-UHFFFAOYSA-N |
| PubChem CID | 2733296 |
| EC No. | 670-569-3 |
| DTXSID | DTXSID50369831 |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 20,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 95,3 |
| Siedepunkt | 72°C 1mm |
| Dichte | 1.045 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.509(lit.) |
| Flammpunkt | 209 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| pKa (Säurekonstante) | 14.68±0.10(Predicted) |
| Aggregatzustand | Liquid |
| Wichte | 1.045 |
| Farbe | Clear colorless |
| InChI | InChI=1S/C8H9FO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| InChIKey | HNIGZVZDWCTFPR-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1F |
| CAS Datenbank | 50919-06-7(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (25%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (25%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29062990 |
| R-Sätze (R) | 36/37/38-21/22-34 |
| Gefahrensymbole | Xn,Xi,C |
| Sicherheitshinweise (S) | 36/37/39-26-45-27-37-23 |
| Gefahrenklasse | IRRITANT |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
2-(2-Fluorophenyl)ethanol is a useful synthetic intermediate. It is used to prepare phenethyl ester derivative analogs of the C-terminal tetrapeptide of gastrin as potent gastrin antagonists.