HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Cyclopentyl chloroformate
Cyclopentyl carbonochloridate · yclopentyl chloroformate · CYCLOPENTYL CHLOROFORMATE · Cyclopentyl carbonochloridoate · CARBONOCHLORIDIC ACID, CYCLOPENTYL ESTER · Cyclopentyl carbonochloridoate, [(Chlorocarbonyl)oxy]cyclopentane, [(Chloroformyl)oxy]cyclopentane
Identifikatoren & physikalische Daten
| CAS No. | 50715-28-1 |
|---|---|
| Summenformel | C6H9ClO2 |
| Durchschnittliche Molmasse | 148,59 g/mol |
| Monoisotopische Masse | 148,02910721 g/mol |
| SMILES | O=C(Cl)OC1CCCC1 |
| InChIKey | ZFQCRLNKHHXELH-UHFFFAOYSA-N |
| PubChem CID | 2735892 |
| EC No. | 411-460-0 |
| DTXSID | DTXSID00371005 |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 108 |
| Siedepunkt | 69.0-70.5 °C(Press: 25 Torr) |
| Dichte | 1.19±0.1 g/cm3(Predicted) |
| Aggregatzustand | liquid |
| Farbe | Brown |
| InChI | InChI=1S/C6H9ClO2/c7-6(8)9-5-3-1-2-4-5/h5H,1-4H2 |
| InChIKey | ZFQCRLNKHHXELH-UHFFFAOYSA-N |
| SMILES | C(Cl)(OC1CCCC1)=O |
| CAS Datenbank | 50715-28-1(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH226: Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P270, P271, P272, P280, P301+P317, P302+P352, P303+P361+P353, P304+P340, P305+P354+P338, P316, P317, P319, P321, P330, P333+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)H226 (66.7%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P262, P264, P264+P265, P270, P271, P272, P280, P301+P316, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P317, P319, P321, P330, P333+P317, P361+P364, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement) |
|---|---|
| Regulatorische Informationen | Status: Active Update: 10-11-2008 https://echa.europa.eu/registration-dossier/-/registered-dossier/3354 |
| Hazard Classes and Categories | Flam. Liq. 3 (100%)Flam. Liq. 3 (66.7%)Flammable liquid - category 3 |
| UN-Transportnummer | UN3277 |
| Zollcode | 2916200090 |
| R-Sätze (R) | 10-22-23-41-43-48/22 |
| Gefahrensymbole | Xi,T |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-36/37/39-45 |
| Gefahrenklasse | 6.1, 8 |
Anwendungen & Verwendung
Verwenden
Cyclopentyl Chloroformate is a chemical reagent used in the synthesis of novel peptidomimetic Hep C protease inhibitors.