HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,6-Dichloro-4-(trifluoromethyl)pyridin-3-amine
2,6-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDIN-3-AMINE · Fluazinam Impurity 3 · 4-AMINO-2,3-DIFLUOROBENZOTRIFLUORIDE · 2,3-DIFLUORO-4-(TRIFLUOROMETHYL)ANILINE · 2,3-DIFLUORO-4-TRIFLUOROMETHYL-PHENYLAMINE · 2,6-Dichloro-4-(trifluoromethyl)-3-pyridinamine · 3-AMINO-2,6-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDINE · 3-Pyridinamine, 2,6-dichloro-4-(trifluoromethyl)-
Identifikatoren & physikalische Daten
| CAS No. | 175277-67-5 |
|---|---|
| Summenformel | C6H3Cl2F3N2 |
| Durchschnittliche Molmasse | 231 g/mol |
| Monoisotopische Masse | 229,962538 g/mol |
| SMILES | Nc1c(C(F)(F)F)cc(Cl)nc1Cl |
| InChIKey | BVJJNBRZQVLPIC-UHFFFAOYSA-N |
| PubChem CID | 2735898 |
| DTXSID | DTXSID40371009 |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 38,9 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 187 |
| Schmelzpunkt | 45-48°C |
| Siedepunkt | 280℃ |
| Dichte | 1.622 |
| Flammpunkt | 123℃ |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2–8 °C |
| Aggregatzustand | crystalline powder |
| pKa (Säurekonstante) | -2.23±0.10(Predicted) |
| Farbe | White |
| CAS Datenbank | 175277-67-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Zollcode | 2933399990 |
|---|---|
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36/37/39 |
| Gefahrenklasse | IRRITANT |
Anwendungen & Verwendung
Verwenden
2,6-Dichloro-4-(trifluoromethyl)pyridin-3-amine is involved in a study of N-phenyl heteroarylamine analogs of fluazinam and their fungicidal activity.