HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Brom-1-ethylpyridiniumtetrafluoroborat
2-bromo-1-ethylpyridin-1-ium tetrafluoroborate · BEPyBr · BEP TETRAFLUOROBORATE · bromoethylpyridiniumtetrafluoroborate · 2-Brom-1-ethylpyridiniumtetrafluoroborat · 2-BROMO-1-ETHYLPYRIDINIUM TETRAFLUOROBOR · 2-Bromo-1-ethylpyridinium tetrafluoroborat · 1-Ethyl-2-bromopyridinium·tetrafluoroborate
Identifikatoren & physikalische Daten
| CAS No. | 878-23-9 |
|---|---|
| Summenformel | C7H9BBrF4N |
| Durchschnittliche Molmasse | 273,86 g/mol |
| Monoisotopische Masse | 272,99475467 g/mol |
| SMILES | CC[n+]1ccccc1Br.F[B-](F)(F)F |
| InChIKey | YJDXVQLBIAJTHP-UHFFFAOYSA-N |
| PubChem CID | 2736300 |
| EC No. | 212-900-2 |
| DTXSID | DTXSID60236646 |
| Lokaler Name | 2-Brom-1-ethylpyridiniumtetrafluoroborat |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 3,9 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 104 |
| Schmelzpunkt | 103-107 °C |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| Aggregatzustand | Crystalline Powder |
| Farbe | White |
| Löslichkeit | very faint turbidity |
| BRN | 4059265 |
| Hauptanwendungen | peptide synthesis |
| InChI | InChI=1S/C7H9BrN.BF4/c1-2-9-6-4-3-5-7(9)82-1(3,4)5/h3-6H,2H2,1H3/q+1 |
| InChIKey | YJDXVQLBIAJTHP-UHFFFAOYSA-N |
| SMILES | [N+]1(CC)C=CC=CC=1Br.[B-](F)(F)(F)F |
| CAS Datenbank | 878-23-9(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (50%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P261, P262, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P330, P361+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (50%) |
| F | 9-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 1759 |
| Zollcode | 29333990 |
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 22-24/25-36/37/39-26 |
| Gefahrenklasse | 8 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Bromo-1-ethylpyridinium Tetrafluoroborate is a carboxyl activation and coupling reagent for peptide synthesis.