HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Chinoxalin-2,3-diol
2,3-DIHYDROXYPHENPIAZINE · usafek-6232 · USAF ek-6232 · DHQ, 10 mM in DMSO · TIMTEC-BB SBB000138 · 2,3-QUINOXALINEDIOL · QUINOXALINE-2,3-DIOL · Dihydroxy quinoxaline
Identifikatoren & physikalische Daten
| CAS No. | 15804-19-0 |
|---|---|
| Summenformel | C8H6N2O2 |
| Durchschnittliche Molmasse | 162,15 g/mol |
| Monoisotopische Masse | 162,04292743 g/mol |
| SMILES | O=c1[nH]c2ccccc2[nH]c1=O |
| InChIKey | ABJFBJGGLJVMAQ-UHFFFAOYSA-N |
| PubChem CID | 27491 |
| ChEMBL | CHEMBL282672 |
| EC No. | 239-901-0 |
| DTXSID | DTXSID9065946 |
| Lokaler Name | Chinoxalin-2,3-diol |
Chemische & physikalische Eigenschaften
| XLogP | 0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 58,2 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 203 |
| Stoffklassen | Nitrogen Compounds -> Other Nitrogen Rings |
| SpringerMaterials Properties | Chemical shift |
| LogP (Verteilungskoeffizient) | 0.2 |
| Löslichkeit | >24.3 [ug/mL] (The mean of the results at pH 7.4) |
| Dampfdruck | 0.00000005 [mmHg] |
| Physical Description | White or light brown powder[Alfa Aesar MSDS] |
| Schmelzpunkt | >300 °C (lit.) |
| Siedepunkt | 288.82°C (rough estimate) |
| Dichte | 1.3264 (rough estimate) |
| Brechungsindex | 1.5770 (estimate) |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| pKa (Säurekonstante) | 10.66±0.20(Predicted) |
| Aggregatzustand | powder to crystaline |
| Farbe | White to Orange to Green |
| BRN | 136884 |
| InChI | InChI=1S/C8H6N2O2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12) |
| InChIKey | ABJFBJGGLJVMAQ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)NC(=O)C1=O |
| CAS Datenbank | 15804-19-0(CAS DataBase Reference) |
| EPA chemische Informationen | 2,3-Quinoxalinedione, 1,4-dihydro- (15804-19-0) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (95.1%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Gefahrenübersicht | May cause irritation[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Acute Tox. 4 (95.1%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29339900 |
| RTECS-Nr. | VD2100000 |
| R-Sätze (R) | 22-37/38-41 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 22-24/25-39-26 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
2,3-Dihydroxyquinoxaline is a fluorescent reagent and it can be used for the determination of trace Pb(II) in vinegar.