HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ciprofibrat
Ciprobrate · Ciprofibric acid · Cipml · Ciprol · Modalim · Lipanor · Win-35833 · CIPROFIBRATE
Identifikatoren & physikalische Daten
| CAS No. | 52214-84-3 |
|---|---|
| Summenformel | C13H14Cl2O3 |
| Durchschnittliche Molmasse | 289,15 g/mol |
| Monoisotopische Masse | 288,03199967 g/mol |
| SMILES | CC(C)(Oc1ccc(C2CC2(Cl)Cl)cc1)C(=O)O |
| InChIKey | KPSRODZRAIWAKH-UHFFFAOYSA-N |
| PubChem CID | 2763 |
| ChEMBL | CHEMBL557555 |
| ChEBI | CHEBI:50867 |
| EC No. | 257-744-6 |
| DTXSID | DTXSID8020331 |
| Lokaler Name | Ciprofibrat |
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 46,5 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 333 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 171.9 Ų [M-H]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: TOXCASTSource Identifier: DTXSID8020331] |
| Schmelzpunkt | 114-116° |
| Siedepunkt | 401.74°C (rough estimate) |
| Dichte | 1.2576 (rough estimate) |
| Brechungsindex | 1.5209 (estimate) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Practically insoluble in water, freely soluble in anhydrous ethanol, soluble in toluene. |
| pKa (Säurekonstante) | 3.31±0.10(Predicted) |
| Aggregatzustand | Solid |
| Farbe | White to Pale Beige |
| Merck | 14,2313 |
| Hauptanwendungen | pharmaceuticalpharmaceutical small molecule |
| InChI | InChI=1S/C13H14Cl2O3/c1-12(2,11(16)17)18-9-5-3-8(4-6-9)10-7-13(10,14)15/h3-6,10H,7H2,1-2H3,(H,16,17) |
| InChIKey | KPSRODZRAIWAKH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=C(C2CC2(Cl)Cl)C=C1)(C)C |
| CAS Datenbank | 52214-84-3(CAS DataBase Reference) |
| EPA chemische Informationen | Propanoic acid, 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methyl- (52214-84-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH350 (95%): May cause cancer [Danger Carcinogenicity]P203, P280, P318, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Carc. 1B (95%) |
| Drug Induced Liver Injury | Drug-Induced Liver Injury Severity and Toxicity (DILIst)ciprofibrateDILI PositiveDOI:10.1016/j.drudis.2019.09.022 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29189900 |
| RTECS-Nr. | UF0880000 |
| R-Sätze (R) | 45 |
| Gefahrensymbole | T |
| Sicherheitshinweise (S) | 53-22-36/37/39-45 |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| Gefahrenklasse | Carc. 1B |
Anwendungen & Verwendung
Beschreibung
Ciprofibrate is a potent, long-acting hypolipidemic agent related to clofibrate, bezafibrate and fenofibrate. It is effective in types IIa, IIb, IIX and IV hyperlipoproteinemias, and produces a beneficial elevation of the anti-atherogenic HDL.
Verwenden
Ciprofibrate is a hypolipemic agent, related structurally to Clofibrate (C586910). Ciprofibrate is used as an antilipemic.