HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4,4-Difluorocyclohexanecarboxylic acid
4,4-difluorocyclohexane-1-carboxylic acid · 4,4-DIFLUOROCYCLOHEXYLCARBOXYLIC ACID · 4,4 - Difluorocyc · Maraviroc Intermediate 1 · 1-Carboxy-4,4-difluorocyclohexane · 4,4 - Difluorocyclohexanecarboxylicd · 4,4-DifluorocyclohexanecarboxylicAci · 4,4-diflurocyclohexane carboxylic acid
Identifikatoren & physikalische Daten
| CAS No. | 122665-97-8 |
|---|---|
| Summenformel | C7H10F2O2 |
| Durchschnittliche Molmasse | 164,15 g/mol |
| Monoisotopische Masse | 164,06488588 g/mol |
| SMILES | O=C(O)C1CCC(F)(F)CC1 |
| InChIKey | HYIUDFLDFSIXTR-UHFFFAOYSA-N |
| PubChem CID | 2779136 |
| EC No. | 602-802-1 |
| DTXSID | DTXSID00381285 |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 158 |
| Schmelzpunkt | 103-107 °C |
| Siedepunkt | 241.1±40.0 °C(Predicted) |
| Dichte | 1.24±0.1 g/cm3(Predicted) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | Chloroform, Methanol |
| pKa (Säurekonstante) | 4.06±0.10(Predicted) |
| Aggregatzustand | Solid |
| Farbe | White |
| InChI | InChI=1S/C7H10F2O2/c8-7(9)3-1-5(2-4-7)6(10)11/h5H,1-4H2,(H,10,11) |
| InChIKey | HYIUDFLDFSIXTR-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCC(F)(F)CC1 |
| CAS Datenbank | 122665-97-8(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29161900 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
4,4-Difluorocyclohexanecarboxylic acid is a di-substituted cyclohexane carboxylic acids used in the synthesis of macrolide antibiotics.