HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2787214Erstellt: 4. November 2026
2-(3-Bromophenyl)-1,3-thiazolidine-4-carboxylic acid
4-Thiazolidinecarboxylic acid, 2-(3-bromophenyl)- · 2-(3-Bromophenyl)-1,3-thiazolidine-4-carboxylic acid
https://huagongshe.com/de/chemical/2787214
Identifikatoren & physikalische Daten
| CAS No. | 118721-56-5 |
|---|
| Summenformel | C10H10BrNO2S |
|---|
| Durchschnittliche Molmasse | 288,16 g/mol |
|---|
| Monoisotopische Masse | 286,96156 g/mol |
|---|
| SMILES | O=C(O)C1CSC(c2cccc(Br)c2)N1 |
|---|
| InChIKey | LZVZEQCJORCGOK-UHFFFAOYSA-N |
|---|
| PubChem CID | 2787214 |
|---|
| EC No. | 970-407-4 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | -0,1 |
|---|
| Polarare Oberfläche (TPSA) | 74,6 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 252 |
|---|
| Schmelzpunkt | 159-161 °C(Solv: ethanol (64-17-5)) |
|---|
| Siedepunkt | 472.7±45.0 °C(Predicted) |
|---|
| Dichte | 1.629±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 1.97±0.40(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
