HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-(2-Chloro-4,5-dimethoxyphenyl)acetic acid
(2-Chloro-4,5-dimethoxy-phenyl)-acetic acid
Identifikatoren & physikalische Daten
| CAS No. | 2898-63-7 |
|---|---|
| Summenformel | C10H11ClO4 |
| Durchschnittliche Molmasse | 230,64 g/mol |
| Monoisotopische Masse | 230,0345865 g/mol |
| SMILES | COc1cc(Cl)c(CC(=O)O)cc1OC |
| InChIKey | WKPCQKQQARFCBD-UHFFFAOYSA-N |
| PubChem CID | 279348 |
| DTXSID | DTXSID10951594 |
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|---|
| Polarare Oberfläche (TPSA) | 55,8 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 221 |
| Lagerbedingungen | -20°C Freezer |
| Löslichkeit | Alcohols, Dichloromethane |
| Aggregatzustand | Solid |
| Farbe | Light Brown |
Anwendungen & Verwendung
Verwenden
2-Chloro-4,5-dimethoxyphenylacetic Acid is an intermediate in the synthesis of 6’-Chloro-norlaudanosoline Hydrobromide (C374750), which is a derivative of Norlaudanosoline (N661425), a key intermediate on the biosynthetic pathway to morphinan and benzylisoquinoline alkaloids.