HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Chloro-5-nitrophthalimide
NHC · N-Heterocyclic Carbene · BUTTPARK 94\57-86 · 4-CHLORO-5-NITROPHTHALIMIDE · 4-CHLORO-5-NITROPHTHALIMIDE 98% · 5-chloro-6-nitroisoindole-1,3-dione · 5-CHLORO-6-NITROISOINDOLINE-1,3-DIONE · 5-Chloro-6-nitrosoisoindoline-1,3-dione
Identifikatoren & physikalische Daten
| CAS No. | 6015-57-2 |
|---|---|
| Summenformel | C8H3ClN2O4 |
| Durchschnittliche Molmasse | 226,57 g/mol |
| Monoisotopische Masse | 225,97813426 g/mol |
| SMILES | O=C1NC(=O)c2cc([N+](=O)[O-])c(Cl)cc21 |
| InChIKey | ADLVDYMTBOSDFE-UHFFFAOYSA-N |
| PubChem CID | 2801129 |
| ChEMBL | CHEMBL2022010 |
| DTXSID | DTXSID00384216 |
Chemische & physikalische Eigenschaften
| XLogP | 1,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 92 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 340 |
| Schmelzpunkt | 201 °C |
| Dichte | 1.725 |
| Brechungsindex | 1.6666 |
| pKa (Säurekonstante) | 6.91±0.20(Predicted) |
| Aggregatzustand | powder |
| Farbe | Yellow |
| BRN | 1536189 |
| InChI | InChI=1S/C8H3ClN2O4/c9-5-1-3-4(2-6(5)11(14)15)8(13)10-7(3)12/h1-2H,(H,10,12,13) |
| InChIKey | ADLVDYMTBOSDFE-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(Cl)C([N+]([O-])=O)=C2)C(=O)N1 |
| CAS Datenbank | 6015-57-2(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Zollcode | 2933998090 |
|---|---|
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-37/39-36 |
Anwendungen & Verwendung
Verwenden
4-Chloro-5-nitropthalimide is a reagent used in the synthesis of novel benzimidazoles as antibacterial agents. Also used to prepare saludiuretic and anti-hypertensive agents.