HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Illudinine
Illudinine · 7,8-Dihydro-9-methoxy-7,7-dimethyl-6H-cyclopent[g]isoquinoline-5-carboxylic acid
Identifikatoren & physikalische Daten
| CAS No. | 18500-63-5 |
|---|---|
| Summenformel | C16H17NO3 |
| Durchschnittliche Molmasse | 271,31 g/mol |
| Monoisotopische Masse | 271,1208434 g/mol |
| SMILES | COc1c2c(c(C(=O)O)c3ccncc13)CC(C)(C)C2 |
| InChIKey | FSBVQCVHOXXMGN-UHFFFAOYSA-N |
| PubChem CID | 282002 |
| ChEBI | CHEBI:216417 |
| DTXSID | DTXSID80300136 |
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 59,4 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 395 |
Anwendungen & Verwendung
Beschreibung
A sesquiterpenoid alkaloid found as a metabolite of Clitocybe illudens. On decarboxylation, the methoxyl group is simultaneously cleaved to yield 7: 7- dimethyl-9-hydroxy-6: 7 -dihydro-8H-cyclopenta [g l-isoq uinoline.