HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 283339Erstellt: 3. November 2026
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenylacetic acid
Benzeneacetic acid, 2,3,5,6-tetrafluoro-4-(trifluoromethyl)-
https://huagongshe.com/de/chemical/283339
Identifikatoren & physikalische Daten
| CAS No. | 32304-29-3 |
|---|
| Summenformel | C9H3F7O2 |
|---|
| Durchschnittliche Molmasse | 276,11 g/mol |
|---|
| Monoisotopische Masse | 276,00212647 g/mol |
|---|
| SMILES | O=C(O)Cc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
|---|
| InChIKey | XFHNUTKYNIQKJU-UHFFFAOYSA-N |
|---|
| PubChem CID | 283339 |
|---|
| EC No. | 813-108-5 |
|---|
| DTXSID | DTXSID60954090 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|
| Polarare Oberfläche (TPSA) | 37,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 9 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 303 |
|---|
| Siedepunkt | 245.4±35.0 °C(Predicted) |
|---|
| Dichte | 1.651±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 3.05±0.10(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
|---|
| Zollcode | 2916399090 |
|---|
