HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Iodo-4-nitrophenol
IFLAB-BB F0243-0017 · 2-IODO-4-NITROPHENOL · 2-Iodo-4-nitrophenol97% · Phenol, 2-iodo-4-nitro- · 2-Iodo-4-nitrophenol 97% · 4-Hydroxy-3-iodonitrobenzene
Identifikatoren & physikalische Daten
| CAS No. | 89487-91-2 |
|---|---|
| Summenformel | C6H4INO3 |
| Durchschnittliche Molmasse | 265,01 g/mol |
| Monoisotopische Masse | 264,92359 g/mol |
| SMILES | O=[N+]([O-])c1ccc(O)c(I)c1 |
| InChIKey | BKQFOYCEUMVWOW-UHFFFAOYSA-N |
| PubChem CID | 284949 |
| EC No. | 624-375-0 |
| DTXSID | DTXSID00301140 |
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 158 |
| Schmelzpunkt | 89-94°C |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | powder |
| Farbe | Lomon |
| BRN | 2519781 |
| InChI | InChI=1S/C6H4INO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H |
| InChIKey | BKQFOYCEUMVWOW-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C([N+]([O-])=O)C=C1I |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 2908990000 |
| R-Sätze (R) | 22 |
| Gefahrensymbole | Xi,Xn |
| Gefahrenklasse | IRRITANTAcute Tox. 4 Oral |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Iodo-4-nitrophenol is used as a reactant in the preparation of iodophenols.