HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 286293Erstellt: 3. November 2026
3-[(4-Methoxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
3-(N-(4-Methoxyphenyl)carbamoyl)-5-norbornene-2-carboxylic acid · Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-[[(4-methoxyphenyl)amino]carbonyl]-, (1R,2S,3R,4S)-rel-
https://huagongshe.com/de/chemical/286293
Identifikatoren & physikalische Daten
| CAS No. | 66662-11-1 |
|---|
| Summenformel | C16H17NO4 |
|---|
| Durchschnittliche Molmasse | 287,31 g/mol |
|---|
| Monoisotopische Masse | 287,11575802 g/mol |
|---|
| SMILES | COc1ccc(NC(=O)C2C3C=CC(C3)C2C(=O)O)cc1 |
|---|
| InChIKey | RVWGVVNUECLEFH-UHFFFAOYSA-N |
|---|
| PubChem CID | 286293 |
|---|
| ChEMBL | CHEMBL1493373 |
|---|
| DTXSID | DTXSID60301560 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|
| Polarare Oberfläche (TPSA) | 75,6 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 453 |
|---|
| Löslichkeit | >43.1 [ug/mL] (The mean of the results at pH 7.4) |
|---|
| Siedepunkt | 557.242±50.00 °C(Press: 760.00 Torr)(predicted) |
|---|
| Dichte | 1.347±0.06 g/cm3(Temp: 25 °CPress: 760 Torr)(predicted) |
|---|
| pKa (Säurekonstante) | 4.231±0.40(predicted) |
|---|
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H315 |
|---|
![Molekülstruktur von 3-[(4-Methoxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid](/img/chemical/286293.png)