HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 288021Erstellt: 3. November 2026
3-(Chlorosulfonyl)-4-ethylbenzoic acid
4-Ethyl-3-(chlorosulfonyl)benzoic acid · Benzoic acid, 3-(chlorosulfonyl)-4-ethyl-
https://huagongshe.com/de/chemical/288021
Identifikatoren & physikalische Daten
| CAS No. | 500596-03-2 |
|---|
| Summenformel | C9H9ClO4S |
|---|
| Durchschnittliche Molmasse | 248,68 g/mol |
|---|
| Monoisotopische Masse | 247,9910076 g/mol |
|---|
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)Cl |
|---|
| InChIKey | SKNKEPXGRHVXFL-UHFFFAOYSA-N |
|---|
| PubChem CID | 288021 |
|---|
| EC No. | 830-361-7 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|
| Polarare Oberfläche (TPSA) | 79,8 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 333 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P264, P270, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P330, P363, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| UN-Transportnummer | UN3261 |
|---|
| Gefahrenklasse | 8 |
|---|
