HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 288342Erstellt: 3. November 2026
4-Bromo-2,3,5,6-tetrachloroaniline
4-Bromo-2,3,5,6-tetrachloroaniline · Benzenamine,4-bromo-2,3,5,6-tetrachloro-
https://huagongshe.com/de/chemical/288342
Identifikatoren & physikalische Daten
| CAS No. | 64186-91-0 |
|---|
| Summenformel | C6H2BrCl4N |
|---|
| Durchschnittliche Molmasse | 309,8 g/mol |
|---|
| Monoisotopische Masse | 306,81247 g/mol |
|---|
| SMILES | Nc1c(Cl)c(Cl)c(Br)c(Cl)c1Cl |
|---|
| InChIKey | CXRJCIAJSARIBR-UHFFFAOYSA-N |
|---|
| PubChem CID | 288342 |
|---|
| EC No. | 182-161-8 |
|---|
| DTXSID | DTXSID40302176 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 5,1 |
|---|
| Polarare Oberfläche (TPSA) | 26 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 12 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 154 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
