HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Chinolin-8-sulfonylchlorid
QUINOLINE-8-SULFONYL CHLORIDE · QSC · SKL275 · AKOS B019400 · ART-CHEM-BB B019400 · 8-Quinolinesulfonyl · 8-quinolylsulfonylchloride · Chinolin-8-sulfonylchlorid
Identifikatoren & physikalische Daten
| CAS No. | 18704-37-5 |
|---|---|
| Summenformel | C9H6ClNO2S |
| Durchschnittliche Molmasse | 227,67 g/mol |
| Monoisotopische Masse | 226,98077711 g/mol |
| SMILES | O=S(=O)(Cl)c1cccc2cccnc12 |
| InChIKey | JUYUYCIJACTHMK-UHFFFAOYSA-N |
| PubChem CID | 29220 |
| EC No. | 242-515-5 |
| DTXSID | DTXSID90171975 |
| Lokaler Name | Chinolin-8-sulfonylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 55,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 298 |
| Schmelzpunkt | 126-129 °C(lit.) |
| Siedepunkt | 306°C |
| Dichte | 1.483±0.06 g/cm3(Predicted) |
| Flammpunkt | 306°C |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| Löslichkeit | methanol: soluble10mg/mL, clear, colorless to light yellow |
| Aggregatzustand | powder to crystal |
| pKa (Säurekonstante) | 0+-.0.17(Predicted) |
| Farbe | White to Orange to Green |
| BRN | 156347 |
| InChI | InChI=1S/C9H6ClNO2S/c10-14(12,13)8-5-1-3-7-4-2-6-11-9(7)8/h1-6H |
| InChIKey | JUYUYCIJACTHMK-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2S(Cl)(=O)=O)C=CC=1 |
| CAS Datenbank | 18704-37-5(CAS DataBase Reference) |
| NIST chemische Informationen | Sulfonyl chloride, 8-quinoline-(18704-37-5) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1C (100%) |
| F | 3-10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 3261 8/PG 2 |
| Zollcode | 29334990 |
| RTECS-Nr. | VC2830000 |
| R-Sätze (R) | 34 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 26-36/37/39-45-27 |
| Gefahrenklasse | 8Skin Corr. 1B |
| Verpackungsgruppe | III |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
8-Quinolinesulfonyl chloride was used as a coupling reagent in oligonucleotide synthesis. It was also used in the synthesis of olefins from secondary esters at moderate temperature