Identifikatoren & physikalische Daten
| CAS No. | 443325-68-6 |
|---|
| Summenformel | C17H21N3O3 |
|---|
| Durchschnittliche Molmasse | 315,37 g/mol |
|---|
| Monoisotopische Masse | 315,15829154 g/mol |
|---|
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C(=O)NCC1CCCO1 |
|---|
| InChIKey | OSYYOPSSNWIUDH-UHFFFAOYSA-N |
|---|
| PubChem CID | 2933840 |
|---|
| ChEMBL | CHEMBL1517781 |
|---|
| DTXSID | DTXSID001330719 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|
| Polarare Oberfläche (TPSA) | 83,2 |
|---|
| H-Brücken-Donoren | 3 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 429 |
|---|
| Löslichkeit | 9 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von N-[2-(1H-indol-3-yl)ethyl]-N'-(oxolan-2-ylmethyl)oxamide](/img/chemical/2933840.png)