1,8-Dihydroxyanthraquinone
DANTRON · DANTHRON · CHRYSAZIN · 1,8-dihydroxyanthracene-9,10-dione · Antrapurol · LTAN · Dionone · Danthrone
Identifikatoren & physikalische Daten
| CAS No. | 117-10-2 |
|---|---|
| Summenformel | C14H8O4 |
| Durchschnittliche Molmasse | 240,21 g/mol |
| Monoisotopische Masse | 240,04225873 g/mol |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cccc21 |
| InChIKey | QBPFLULOKWLNNW-UHFFFAOYSA-N |
| PubChem CID | 2950 |
| ChEMBL | CHEMBL53418 |
| ChEBI | CHEBI:3682 |
| EC No. | 204-173-5 |
| DTXSID | DTXSID9020328 |
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 74,6 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 346 |
| Schmelzpunkt | 191-193 °C (lit.) |
| Siedepunkt | 342.92°C (rough estimate) |
| Dichte | 1.3032 (rough estimate) |
| Brechungsindex | 1.5430 (estimate) |
| Flammpunkt | >200°C |
| Lagerbedingungen | Sealed in dry,2-8°C |
| Löslichkeit | very faint turbidity in hot Acetic acidinsoluble |
| Aggregatzustand | Powder |
| pKa (Säurekonstante) | 6.27±0.20(Predicted) |
| Farbe | Orange-brown or brown |
| Merck | 14,2815 |
| BRN | 2054727 |
| Henry-Konstante | 1.8×105 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | 1S/C14H8O4/c15-9-5-1-3-7-11(9)14(18)12-8(13(7)17)4-2-6-10(12)16/h1-6,15-16H |
| InChIKey | QBPFLULOKWLNNW-UHFFFAOYSA-N |
| SMILES | Oc1cccc2C(=O)c3cccc(O)c3C(=O)c12 |
| LogP (Verteilungskoeffizient) | 4.570 (est) |
| CAS Datenbank | 117-10-2(CAS DataBase Reference) |
| NIST chemische Informationen | 1,8-Dihydroxyanthraquinone(117-10-2) |
| EPA chemische Informationen | Danthron (117-10-2) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 1 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 2811 |
| Zollcode | 29146990 |
| RTECS-Nr. | CB6650000 |
| R-Sätze (R) | 40 |
| Toxizität | LD50 orally in mice: <7 g/kg (Case) |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36/37-36-22 |
| Gefahrenklasse | IRRITANTCarc. 2Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 117-10-2(Hazardous Substances Data) |
Anwendungen & Verwendung
Beschreibung
Danthron, a natural product, was originally extracted from the roots and rhizome of Polygonaceae plant, also called Da Huang in traditional Chinese herbal medicine. Now it is synthesized in many countries, such as Germany, India, Japan, Poland, the United Kingdom, and the United States. Danthron is reasonably anticipated to be a human carcinogen. Danthron is an anthraquinone that exists at room temperature as a red or orange crystalline powder.It is practically insoluble in water, but soluble in a variety of solvents (acetone, chloroform, diethyl ether, ethanol) and alkaline hydroxide solutions. The stability of danthron is generally good. It is stable under room temperatures and normal pressures.
Verwenden
1,8-Dihydroxyanthraquinone can be used:To prepare an inclusion complex with β-cyclodextrin, applicable as a sensor in the estimation of Cu2+ions in an aqueous solution.As a starting material in the synthesis of 1,4,5,8-tetramethoxyanthracene.As an aromatic scavenger in the modification of lignin, which acts as a corrosion inhibitor for steel.