HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Amino-6-bromopyridine
6-Bromopyridin-2-amine · 2-AMINO-6-BROMO-PHENOL · 6-BROMO-PYRIDIN-2-YLAMINE · 19798-81-3 · Aminobromopyridine · 2-AMINO-6-BROMPYRIDINE · 6-BROMO-2-AMINOPYRIDINE · 2A6BP
Identifikatoren & physikalische Daten
| CAS No. | 19798-81-3 |
|---|---|
| Summenformel | C5H5BrN2 |
| Durchschnittliche Molmasse | 173,01 g/mol |
| Monoisotopische Masse | 171,96361026 g/mol |
| SMILES | Nc1cccc(Br)n1 |
| InChIKey | BKLJUYPLUWUEOQ-UHFFFAOYSA-N |
| PubChem CID | 300809 |
| ChEMBL | CHEMBL2426226 |
| EC No. | 606-385-7 |
| DTXSID | DTXSID00306418 |
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 38,9 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 76,8 |
| Schmelzpunkt | 88-91 °C (lit.) |
| Siedepunkt | 273.0±20.0 °C(Predicted) |
| Dichte | 1.710±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | Chloroform (Slightly), Methanol (Very Slightly)Slightly soluble in water. |
| pKa (Säurekonstante) | 2.73±0.24(Predicted) |
| Aggregatzustand | Powder |
| Farbe | Slightly yellow to light brown |
| InChI | InChI=1S/C5H5BrN2/c6-4-2-1-3-5(7)8-4/h1-3H,(H2,7,8) |
| InChIKey | BKLJUYPLUWUEOQ-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(Br)=CC=C1 |
| CAS Datenbank | 19798-81-3(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (16.4%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 55 reports by companies from 11 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 20-07-2021 https://echa.europa.eu/registration-dossier/-/registered-dossier/30711 |
| Hazard Classes and Categories | Acute Tox. 4 (16.4%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29333999 |
| R-Sätze (R) | 36/37/38-20/21/22 |
| Gefahrensymbole | Xi,Xn |
| Sicherheitshinweise (S) | 26-36-36/37/39 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Amino-6-bromopyridine is a disubstituted pyridine used as a building block in the preparation of nitrogen containing bicyclic and polycylic compounds.