HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 30133Erstellt: 3. November 2026
Norapomorphine
norapomorphine · R-(-)-Norapomorphine · R(-)-NORAPOMORPHINE HBR · R(-)-NORAPOMORPHINE HYDROBROMIDE DOPAMIN E AGONIST · 4H-Dibenzo[de,g]quinoline-10,11-diol, 5,6,6a,7-tetrahydro-, (6aR)- · NorapomorphineQ: What is Norapomorphine Q: What is the CAS Number of Norapomorphine
https://huagongshe.com/de/chemical/30133
Identifikatoren & physikalische Daten
| CAS No. | 478-76-2 |
|---|
| Summenformel | C16H15NO2 |
|---|
| Durchschnittliche Molmasse | 253,29 g/mol |
|---|
| Monoisotopische Masse | 253,11027872 g/mol |
|---|
| SMILES | Oc1ccc2c(c1O)-c1cccc3c1[C@@H](C2)NCC3 |
|---|
| InChIKey | MHPQCGZBAVXCGA-GFCCVEGCSA-N |
|---|
| PubChem CID | 30133 |
|---|
| ChEMBL | CHEMBL190519 |
|---|
| DTXSID | DTXSID40197286 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|
| Polarare Oberfläche (TPSA) | 52,5 |
|---|
| H-Brücken-Donoren | 3 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 348 |
|---|
| Siedepunkt | 501.5±50.0 °C(Predicted) |
|---|
| Dichte | 1.328±0.06 g/cm3(Predicted) |
|---|
| Lagerbedingungen | 2-8°C |
|---|
| pKa (Säurekonstante) | 9.40±0.20(Predicted) |
|---|
| Aggregatzustand | solid |
|---|
| Farbe | white |
|---|
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | - |
|---|
| R-Sätze (R) | 20/21/22-36/37/38 |
|---|
| Gefahrensymbole | Xn |
|---|
| Sicherheitshinweise (S) | 26-36 |
|---|
