HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-(3,4-Dihydroxyphenyl)-2-((1,1-dimethylethyl)amino)ethanone
1-Oxo Colterol · 1-(3,4-Dihydroxyphenyl)-2-[(1,1-dimethylethyl)amino]ethanone · Ethanone, 1-(3,4-dihydroxyphenyl)-2-[(1,1-dimethylethyl)amino]-
Identifikatoren & physikalische Daten
| CAS No. | 105644-17-5 |
|---|---|
| Summenformel | C12H17NO3 |
| Durchschnittliche Molmasse | 223,27 g/mol |
| Monoisotopische Masse | 223,1208434 g/mol |
| SMILES | CC(C)(C)NCC(=O)c1ccc(O)c(O)c1 |
| InChIKey | RNGOPMBKNLMANA-UHFFFAOYSA-N |
| PubChem CID | 3015705 |
| DTXSID | DTXSID50388486 |
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 69,6 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 247 |
| Schmelzpunkt | 199–201°C |
| Siedepunkt | 411.4±40.0 °C(Predicted) |
| Dichte | 1.158±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Hygroscopic, -86°C Freezer, Under inert atmosphere |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 7.32±0.20(Predicted) |
| Aggregatzustand | Solid |
| Farbe | Pale Beige |
| Stabilität | Air Sensitive |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Colterol (C215850) derivative.
Herstellung & Synthese
synthetische
Preparation by demethylation of 2-tert-butylamino1-(3,4-dimethoxyphenyl)ethanone hydrochloride with aqueous hydrobromic acid.