HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 307484Erstellt: 4. November 2026
2,2,2-trifluoroethyl N-(4-methyl-3-{[(2,2,2-trifluoroethoxy)carbonyl]amino}phenyl)carbamate
Carbamic acid, N,N'-(4-methyl-1,3-phenylene)bis-, C,C'-bis(2,2,2-trifluoroethyl) ester · 2,2,2-Trifluoroethyl N-(4-methyl-3-{[(2,2,2-trifluoroethoxy)carbonyl]amino}phenyl)carbamate
https://huagongshe.com/de/chemical/307484
Identifikatoren & physikalische Daten
| CAS No. | 216142-84-6 |
|---|
| Summenformel | C13H12F6N2O4 |
|---|
| Durchschnittliche Molmasse | 374,24 g/mol |
|---|
| Monoisotopische Masse | 374,07012584 g/mol |
|---|
| SMILES | Cc1ccc(NC(=O)OCC(F)(F)F)cc1NC(=O)OCC(F)(F)F |
|---|
| InChIKey | NFCSOMUIDKOUFP-UHFFFAOYSA-N |
|---|
| PubChem CID | 307484 |
|---|
| EC No. | 108-164-6 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|
| Polarare Oberfläche (TPSA) | 76,7 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 10 |
|---|
| Frei drehbare Bindungen | 6 |
|---|
| Schwere Atome | 25 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 468 |
|---|
| Siedepunkt | 289.4±40.0 °C(Predicted) |
|---|
| Dichte | 1.494±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 12.40±0.70(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
![Molekülstruktur von 2,2,2-trifluoroethyl N-(4-methyl-3-{[(2,2,2-trifluoroethoxy)carbonyl]amino}phenyl)carbamate](/img/chemical/307484.png)