HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5-(Chlorosulfonyl)-2-methylbenzoic acid
5-(Chlorosulfonyl) · 5-(Chlorosulphonyl)-2-methylbenzoic acid · Benzoic acid, 5-(chlorosulfonyl)-2-methyl- · Benzoic acid, 5-(chlorosulfonyl)-2-methyl- (9CI) · 5-(chlorosulfonyl)-2-methylbenzenecarboxylic acid · 5-(Chlorosulphonyl)-o-toluic acid, 3-Carbonyl-4-methylbenzenesulphonyl chloride
Identifikatoren & physikalische Daten
| CAS No. | 89001-57-0 |
|---|---|
| Summenformel | C8H7ClO4S |
| Durchschnittliche Molmasse | 234,66 g/mol |
| Monoisotopische Masse | 233,97535738 g/mol |
| SMILES | Cc1ccc(S(=O)(=O)Cl)cc1C(=O)O |
| InChIKey | FMWIOAWRARBKDQ-UHFFFAOYSA-N |
| PubChem CID | 308449 |
| EC No. | 630-087-6 |
| DTXSID | DTXSID30308844 |
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 79,8 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 319 |
| Schmelzpunkt | 152-154° |
| Siedepunkt | 398.7±35.0 °C(Predicted) |
| Dichte | 1.514±0.06 g/cm3(Predicted) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| pKa (Säurekonstante) | 2.57±0.25(Predicted) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| UN-Transportnummer | UN3261 |
| Zollcode | 2916399090 |
| Gefahrenklasse | IRRITANT |
Anwendungen & Verwendung
Verwenden
5-(Chlorosulfonyl)-2-methylbenzoic acid