HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Imerubrine
imerubrine · 4,5,6,9-Tetramethoxy-10H-azuleno[1,2,3-ij]isoquinolin-10-one · 10H-Azuleno[1,2,3-ij]isoquinolin-10-one, 4,5,6,9-tetramethoxy-
Identifikatoren & physikalische Daten
| CAS No. | 58189-33-6 |
|---|---|
| Summenformel | C20H17NO5 |
| Durchschnittliche Molmasse | 351,4 g/mol |
| Monoisotopische Masse | 351,11067264 g/mol |
| SMILES | COc1c(OC)c2c3c(nccc3c1OC)-c1cc(=O)c(OC)ccc1-2 |
| InChIKey | UNLMKMRFVJZAEV-UHFFFAOYSA-N |
| PubChem CID | 3085136 |
| ChEMBL | CHEMBL155844 |
| DTXSID | DTXSID30206912 |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 26 |
| Formalladung | 0 |
| Komplexität | 682 |
Anwendungen & Verwendung
Beschreibung
A further alkaloid obtained from the stems of Abuta imene and A. rufescens, this base has been shown to possess the structure given above.