HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,3-Dichloro-2-methoxy-5-nitrobenzene
NSC 212118 · 4-Nitro-2,6-dichloroanisole · 2,6-Dichloro-4-nitroanisole · 1,3-Dichloro-2-Methoxy-5-Nitro · 2,6-Dichloro-4-nitroanisole>2,6-DICHLORO-4-NITROANISOLE 99% · 2,6-Dichloro-4-nitroanisole, 98% · 3,5-Dichloro-4-methoxynitrobenzene · 2.6-Dichlor-4-nitro-1-Methoxy-benzol
Identifikatoren & physikalische Daten
| CAS No. | 17742-69-7 |
|---|---|
| Summenformel | C7H5Cl2NO3 |
| Durchschnittliche Molmasse | 222,02 g/mol |
| Monoisotopische Masse | 220,96464838 g/mol |
| SMILES | COc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChIKey | GJYVJKPFYCKNEC-UHFFFAOYSA-N |
| PubChem CID | 309716 |
| EC No. | 403-350-6 |
| DTXSID | DTXSID00938930 |
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 55,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 185 |
| SpringerMaterials Properties | Diamagnetic susceptibility |
| Schmelzpunkt | 97-100 °C |
| Siedepunkt | 305.6±37.0 °C(Predicted) |
| Dichte | 1.5223 (rough estimate) |
| Brechungsindex | 1.6140 (estimate) |
| Flammpunkt | 160 °C |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | DMSO (Sparingly), Chloroform (Slightly) |
| Aggregatzustand | Solid |
| Farbe | Pale Yellow to Yellow |
| CAS Datenbank | 17742-69-7(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P273, P301+P316, P321, P330, P391, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Regulatorische Informationen | Status: Cease Manufacture Update: 16-08-2010 https://echa.europa.eu/registration-dossier/-/registered-dossier/4129 |
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| UN-Transportnummer | 2811 |
| Zollcode | 29049095 |
| R-Sätze (R) | 51/53-25 |
| Gefahrensymbole | N-T,T,N |
| hazard_note | Toxic |
| Sicherheitshinweise (S) | 61-45-36/37 |
| Gefahrenklasse | IRRITANT |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Verwenden
2,6-Dichloro-4-nitroanisole can be used for thyroid hormone receptor agonists.