HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-(Bromomethyl)acrylic acid ethyl ester
Ethyl Bromomethacrylate · Ethyl 2-(bromomethyl)prop-2-enoate · 3-bromo-2-methyl-2-propenoic acid ethyl ester · DK588 · NSC 215252 · DKFELEX0148 · 2-Carbethoxyallyl Bromide · Ethyl2-(Bromomethyl)acrvlate
Identifikatoren & physikalische Daten
| CAS No. | 17435-72-2 |
|---|---|
| Summenformel | C6H9BrO2 |
| Durchschnittliche Molmasse | 193,04 g/mol |
| Monoisotopische Masse | 191,97859 g/mol |
| SMILES | C=C(CBr)C(=O)OCC |
| InChIKey | MTCMFVTVXAOHNQ-UHFFFAOYSA-N |
| PubChem CID | 310620 |
| EC No. | 628-033-1 |
| DTXSID | DTXSID10309738 |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 120 |
| Schmelzpunkt | 134-136℃ |
| Siedepunkt | 38 °C/0.8 mmHg (lit.) |
| Dichte | 1.398 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.479(lit.) |
| Flammpunkt | 178 °F |
| Lagerbedingungen | -20°C |
| Löslichkeit | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| Aggregatzustand | Liquid |
| Farbe | Colorless to pale yellow |
| BRN | 970108 |
| InChI | InChI=1S/C6H9BrO2/c1-3-9-6(8)5(2)4-7/h2-4H2,1H3 |
| InChIKey | MTCMFVTVXAOHNQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(CBr)=C |
| CAS Datenbank | 17435-72-2(CAS DataBase Reference) |
Sicherheit & Vorschriften
| F | 10-19-23 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2810 6.1 / PGII |
| Zollcode | 29161900 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Gefahrenklasse | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
Anwendungen & Verwendung
Verwenden
ETHYL 2-(BROMOMETHYL)ACRYLATE is an intermediate used for the synthesis of aza inhibitors of chorismate mutase.