HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Drofenine
Adiphenine H · Trasentin-6H · Cycloadiphene · AGJBLWCLQCKRJP-UHFFFAOYSA-N · 2-(DiethylaMino)ethyl 2-cyclohexyl-2-phenylacetate · α-Cyclohexylbenzeneacetic acid 2-(diethylamino)ethyl ester · Benzeneacetic acid, α-cyclohexyl-, 2-(diethylamino)ethyl ester
Identifikatoren & physikalische Daten
| CAS No. | 1679-76-1 |
|---|---|
| Summenformel | C20H31NO2 |
| Durchschnittliche Molmasse | 317,5 g/mol |
| Monoisotopische Masse | 317,23547923 g/mol |
| SMILES | CCN(CC)CCOC(=O)C(c1ccccc1)C1CCCCC1 |
| InChIKey | AGJBLWCLQCKRJP-UHFFFAOYSA-N |
| PubChem CID | 3166 |
| ChEMBL | CHEMBL442444 |
| ChEBI | CHEBI:93825 |
| EC No. | 605-497-3 |
| DTXSID | DTXSID0048472 |
Chemische & physikalische Eigenschaften
| XLogP | 5,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 29,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 329 |
| Arzneimittel | Pharmaceutical |
| Human Drugs | Pharmaceuticals |
| Collision Cross Section | 175.92 Ų [M+K]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| Siedepunkt | bp0.15 158° |
| Dichte | 1.0047 g/cm3 |
| pKa (Säurekonstante) | 9.21±0.25(Predicted) |