HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-Methylbut-3-en-1-yl 4-methylbenzene-1-sulfonate
1-methyl-4-(3-methylbut-3-enoxysulfonyl)benzene · 1-Methyl-4-(3-methylbutane-3-phenoxysulfonyl)benzene · 3-Buten-1-ol, 3-methyl-, 1-(4-methylbenzenesulfonate)
Identifikatoren & physikalische Daten
| CAS No. | 781-03-3 |
|---|---|
| Summenformel | C12H16O3S |
| Durchschnittliche Molmasse | 240,32 g/mol |
| Monoisotopische Masse | 240,08201537 g/mol |
| SMILES | C=C(C)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChIKey | KKRCXGGGEPQALO-UHFFFAOYSA-N |
| PubChem CID | 317686 |
| DTXSID | DTXSID80312173 |
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 51,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 319 |
| Löslichkeit | soluble in Chloroform, DCM, Ethyl Acetate |
| Aggregatzustand | Liquid |
| Farbe | Yellow |
Anwendungen & Verwendung
Verwenden
Isopentenyl Tosylate is an intermediate in the synthesis of Isopentenyl Pyrophosphate Triammonium Salt (I821850) which is used for the preparation of antitumor agents phosphohalohydrins.