HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,3,5,6-Tetrabrom-p-xylol
p-Tbx · Tetrabromo-p-xylen · 6-TETRABROMO-P-XYLENE · 2,3,5,6-Tetrabrom-p-xylol · 2,3,5,6-tetrabromo-p-xylen · 1,4-Bis(dibrommethyl)benzen · 2,3,5,6-TETRABROMO-P-XYLENE · 1,4-DIMETHYLTETRABROMOBENZENE
Identifikatoren & physikalische Daten
| CAS No. | 23488-38-2 |
|---|---|
| Summenformel | C8H6Br4 |
| Durchschnittliche Molmasse | 421,75 g/mol |
| Monoisotopische Masse | 417,72029859 g/mol |
| SMILES | Cc1c(Br)c(Br)c(C)c(Br)c1Br |
| InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N |
| PubChem CID | 31952 |
| EC No. | 245-688-5 |
| DTXSID | DTXSID8052697 |
| Lokaler Name | 2,3,5,6-Tetrabrom-p-xylol |
Chemische & physikalische Eigenschaften
| XLogP | 5,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 127 |
| Schmelzpunkt | 254-256 °C(lit.) |
| Siedepunkt | 303.01°C (rough estimate) |
| Dichte | 2.258 |
| Brechungsindex | 1.7040 (estimate) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) |
| Aggregatzustand | Solid |
| Farbe | Off-White |
| InChI | InChI=1S/C8H6Br4/c1-3-5(9)7(11)4(2)8(12)6(3)10/h1-2H3 |
| InChIKey | RXKOKVQKECXYOT-UHFFFAOYSA-N |
| SMILES | C1(Br)=C(C)C(Br)=C(Br)C(C)=C1Br |
| EPA chemische Informationen | 2,3,5,6-Tetrabromo-p-xylene (23488-38-2) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Chemical: Benzene, 1,2,4,5-tetrabromo-3,6-dimethyl-Hazard Traits - Hazard Trait Undefined |
| Weitere Sicherheitsinformationen | Evaluation - Chemicals not considered for in depth evaluation - Not commercially active in Australia |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | 1759 |
| Zollcode | 2903998090 |
| RTECS-Nr. | ZE5170000 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-37/39 |
| Gefahrenklasse | 8 |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Verwenden
2,3,5,6-Tetrabromo-p-xylene is a novel chemical flame retardant which may act as an environmental pollutant and contaminant such as within the endangered European eel (Anguilla anguilla) species.