HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
8-Bromadenosin-cyclisch-3',5'-(hydrogenphosphat)
8-BR-CAMP · 8-BROMO-CAMP · B-cAMP · 8-Br-A-3:5-MP · 8-BR-CAMP,98+% · 8-Bromocyclic AMP · Cyclic amp, 8-bromo · -CyclicMonophosphate
Identifikatoren & physikalische Daten
| CAS No. | 23583-48-4 |
|---|---|
| Summenformel | C10H11BrN5O6P |
| Durchschnittliche Molmasse | 408,1 g/mol |
| Monoisotopische Masse | 406,96303 g/mol |
| SMILES | Nc1ncnc2c1nc(Br)n2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H]1O |
| InChIKey | DVKQVRZMKBDMDH-UUOKFMHZSA-N |
| PubChem CID | 32014 |
| ChEMBL | CHEMBL1626177 |
| ChEBI | CHEBI:64211 |
| EC No. | 245-760-6 |
| Lokaler Name | 8-Bromadenosin-cyclisch-3',5'-(hydrogenphosphat) |
Chemische & physikalische Eigenschaften
| XLogP | -1,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 155 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 10 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 532 |
| Schmelzpunkt | 254 °C (dec.) (lit.) |
| Siedepunkt | 741.9±70.0 °C(Predicted) |
| Dichte | 2.80±0.1 g/cm3(Predicted) |
| Lagerbedingungen | -20°C |
| Löslichkeit | aqueous base: soluble |
| pKa (Säurekonstante) | 0.95±0.60(Predicted) |
| Aggregatzustand | Powder |
| Farbe | Pale Brown |
| BRN | 591930 |
| InChI | 1S/C10H11BrN5O6P/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-5(17)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,17H,1H2,(H,18,19)(H2,12,13,14)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DVKQVRZMKBDMDH-UUOKFMHZSA-N |
| SMILES | Nc1ncnc2n([C@@H]3O[C@@H]4COP(O)(=O)O[C@H]4[C@H]3O)c(Br)nc12 |
Sicherheit & Vorschriften
| F | 3-10 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29349990 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
8-Bromoadenosine 3′,5′-cyclic monophosphate has been used:to treat H295R cells as positive controls for CYP19 inductionas a membrane permeable cAMP analog to study its effect on short-circuit current (Isc)to investigate its potential as an inducer of differentiation in Wharton′s jelly-derived mesenchymal stem cells (WJ-MSCs)