HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(3β,18α,20β)-3-Hydroxy-11-oxoolean-12-en-29-sure
Nsc 35350 · Triterpene · Ccris 3963 · Brn 2956366 · Einecs 215-907-9 · 18α-Glycyrrhetinic · Enoxolone impurity A · 18a-Glycyrrhetic acid
Identifikatoren & physikalische Daten
| CAS No. | 1449-05-4 |
|---|---|
| Summenformel | C30H46O4 |
| Durchschnittliche Molmasse | 470,7 g/mol |
| Monoisotopische Masse | 470,33960994 g/mol |
| SMILES | CC1(C(=O)O)CCC2(C)CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 |
| InChIKey | MPDGHEJMBKOTSU-UHFFFAOYSA-N |
| PubChem CID | 3230 |
| ChEMBL | CHEMBL1863561 |
| DTXSID | DTXSID50859383 |
| Lokaler Name | (3β,18α,20β)-3-Hydroxy-11-oxoolean-12-en-29-sure |
Chemische & physikalische Eigenschaften
| XLogP | 6,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 74,6 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 34 |
| Formalladung | 0 |
| Komplexität | 965 |
| LogP (Verteilungskoeffizient) | 4.77 |
| Schmelzpunkt | 331-333°C |
| Siedepunkt | 492.11°C (rough estimate) |
| Dichte | 0.9967 (rough estimate) |
| Brechungsindex | 1.4800 (estimate) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 4.71±0.70(Predicted) |
| Farbe | White to Off-White |
| InChIKey | MPDGHEJMBKOTSU-PMTKVOBESA-N |
| SMILES | [H][C@]12C[C@](C)(CC[C@]1(C)CC[C@]3(C)C2=CC(=O)C4[C@@]5(C)CC[C@H](O)C(C)(C)[C@]5([H])CC[C@@]34C)C(O)=O |
| LogP (Verteilungskoeffizient) | 6.570 (est) |
| CAS Datenbank | 1449-05-4(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29189900 |
| RTECS-Nr. | RK0190000 |
| R-Sätze (R) | 22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | ection |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 Oral |
Anwendungen & Verwendung
Verwenden
18α-Glycyrrhetinic acid may be used to synthesize:3-keto-18α-glycyrrhetinic acid methyl esters of 18α-glycyrrhetinic acidmethyl esters of 3-keto-18α-glycyrrhetinic acid