HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(4-(4-Aminobenzoyl)oxyphenyl) 4-aminobenzoate
ABHQ · 1,4-Bis(4-aminobenzoyloxy)benzene · 1,4-Phenylene bis(4-aminobenzoate) · benzene-1,4-diyl bis(4-aminobenzoate) · 1,4-Benzenediol, 1,4-bis(4-aminobenzoate) · [4-(4-aminobenzoyl)oxyphenyl] 4-aminobenzoate · [4-(4-aminobenzoyl)oxyphenyl] 4-aminobenzoate (ABHQ)
Identifikatoren & physikalische Daten
| CAS No. | 22095-98-3 |
|---|---|
| Summenformel | C20H16N2O4 |
| Durchschnittliche Molmasse | 348,4 g/mol |
| Monoisotopische Masse | 348,111007 g/mol |
| SMILES | Nc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(N)cc3)cc2)cc1 |
| InChIKey | FPXWISWMBLVKOD-UHFFFAOYSA-N |
| PubChem CID | 323908 |
| EC No. | 881-299-2 |
| DTXSID | DTXSID50314669 |
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 105 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 26 |
| Formalladung | 0 |
| Komplexität | 430 |
| SpringerMaterials Properties | Chemical structure |
| Schmelzpunkt | 310 °C |
| Siedepunkt | 608.6±50.0 °C(Predicted) |
| Dichte | 1.335±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 2.21±0.10(Predicted) |
| InChI | InChI=1S/C20H16N2O4/c21-15-5-1-13(2-6-15)19(23)25-17-9-11-18(12-10-17)26-20(24)14-3-7-16(22)8-4-14/h1-12H,21-22H2 |
| InChIKey | FPXWISWMBLVKOD-UHFFFAOYSA-N |
| SMILES | C1(OC(=O)C2=CC=C(N)C=C2)=CC=C(OC(=O)C2=CC=C(N)C=C2)C=C1 |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
[4-(4-aminobenzoyl)oxyphenyl] 4-aminobenzoate is an organic carboxylic acid ester and can be used as a pharmaceutical intermediate.