HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 329952Erstellt: 1. November 2026
5-Methyl-6-phenylimidazo[2,1-b][1,3]thiazole
Imidazo[2,1-b]thiazole,5-methyl-6-phenyl- · 5-methyl-6-phenylimidazo[2,1-b][1,3]thiazole · 2-Phenyl-3-methylimidazo[1,2-b]thiazole
https://huagongshe.com/de/chemical/329952
Identifikatoren & physikalische Daten
| CAS No. | 51226-38-1 |
|---|
| Summenformel | C12H10N2S |
|---|
| Durchschnittliche Molmasse | 214,29 g/mol |
|---|
| Monoisotopische Masse | 214,0564695 g/mol |
|---|
| SMILES | Cc1c(-c2ccccc2)nc2sccn12 |
|---|
| InChIKey | AYMDAFMHIPIUQI-UHFFFAOYSA-N |
|---|
| PubChem CID | 329952 |
|---|
| EC No. | 109-774-5 |
|---|
| DTXSID | DTXSID90317396 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,9 |
|---|
| Polarare Oberfläche (TPSA) | 45,5 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 228 |
|---|
| Dichte | 1.26±0.1 g/cm3(Predicted) |
|---|
| Aggregatzustand | solid |
|---|
| pKa (Säurekonstante) | 6.30±0.40(Predicted) |
|---|
| InChI | 1S/C12H10N2S/c1-9-11(10-5-3-2-4-6-10)13-12-14(9)7-8-15-12/h2-8H,1H3 |
|---|
| InChIKey | AYMDAFMHIPIUQI-UHFFFAOYSA-N |
|---|
| SMILES | CC1=C(C2=CC=CC=C2)N=C3N1C=CS3 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P354+P338, P317, P330, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Wassergefährdungsklasse (WGK) | WGK 3 |
|---|
| Lagerklasse | 11 - Combustible Solids |
|---|
| Gefahrenklasse | Acute Tox. 4 OralEye Dam. 1 |
|---|
![Molekülstruktur von 5-Methyl-6-phenylimidazo[2,1-b][1,3]thiazole](/img/chemical/329952.png)