5-Brom-2-chlorbenzoesaeure
BCBA · 2-CHLORO-5-BROMOBENZOIC ACID · 5-Br-2-CI Benzoic acid · 5-bromo-2-chlorobenzoate · 5-Bromo-2-chlorobenzoicaci · Empagliflozin Impurity 182 · 5-BROMO-2-CHLOROBENZOIC ACID · 2-chloro 5-bromo bezoic acid
Identifikatoren & physikalische Daten
| CAS No. | 21739-92-4 |
|---|---|
| Summenformel | C7H4BrClO2 |
| Durchschnittliche Molmasse | 235,46 g/mol |
| Monoisotopische Masse | 233,90831915 g/mol |
| SMILES | O=C(O)c1cc(Br)ccc1Cl |
| InChIKey | FGERXQWKKIVFQG-UHFFFAOYSA-N |
| PubChem CID | 33127 |
| EC No. | 244-558-5 |
| DTXSID | DTXSID40176132 |
| Lokaler Name | 5-Brom-2-chlorbenzoesaeure |
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 163 |
| Schmelzpunkt | 154-156 °C (lit.) |
| Siedepunkt | 324.5±27.0 °C(Predicted) |
| Dichte | 1.7312 (rough estimate) |
| Brechungsindex | 1.5590 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | 2.63g/lSoluble in water 2.63 g/L @20°C. |
| pKa (Säurekonstante) | 2.49±0.25(Predicted) |
| Aggregatzustand | Solid |
| Farbe | Off white colored powder |
| BRN | 2691432 |
| InChI | InChI=1S/C7H4BrClO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | FGERXQWKKIVFQG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC=C1Cl |
| CAS Datenbank | 21739-92-4(CAS DataBase Reference) |
| NIST chemische Informationen | 5-Bromo-2-chlorobenzoic acid(21739-92-4) |
| EPA chemische Informationen | Benzoic acid, 5-bromo-2-chloro- (21739-92-4) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 53 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance.Status: Active Update: 19-07-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/20063 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29163900 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-37/39 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Beschreibung
5-Bromo-2-chlorobenzoic acid (BCBA) is an organic reagent that can be used in electroinduced dehalogenation reactions. Ag/Cu electrodes exhibit high electrocatalytic activity in the dehalogenation reaction of BCBA. The process is characterised by a sequence of halide excretion and hydrogen addition. Since the bond dissociation energy value of C-Br bond is smaller than that of C-Cl bond, Br-w is more easily released from the benzene ring. As C-Br breaks, BCBA gains electrons and hydrogen to form the intermediate 2-chlorobenzoate. C-Cl then breaks in the same way to give the final product benzoate.
Verwenden
5-Bromo-2-chlorobenzoic acid was used to evaluate the homogeneity of organic powder. It can be used to produce 2-chloro-5-deuteriobenzoic acid.