HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(Methyl-ONN-azoxy)methane
AOM · Azoxy · collagen type 2 · ANFH · SEDC · STL1 · COL11A3 · azoxy-methan
Identifikatoren & physikalische Daten
| CAS No. | 25843-45-2 |
|---|---|
| Summenformel | C2H6N2O |
| Durchschnittliche Molmasse | 74,08 g/mol |
| Monoisotopische Masse | 74,04801282 g/mol |
| SMILES | CN=[N+](C)[O-] |
| InChIKey | DGAKHGXRMXWHBX-UHFFFAOYSA-N |
| PubChem CID | 33184 |
| ChEBI | CHEBI:232612 |
| DTXSID | DTXSID70860350 |
Chemische & physikalische Eigenschaften
| XLogP | -0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 41,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 5 |
| Formalladung | 0 |
| Komplexität | 49,6 |
| Siedepunkt | 97-99 °C (lit.) |
| Dichte | 0.991 g/mL at 25 °C (lit.) |
| Brechungsindex | 1.4368 (estimate) |
| Flammpunkt | 24 °C |
| Lagerbedingungen | -20°C |
| Löslichkeit | Soluble in water, ethanol, and ether |
| Aggregatzustand | Liquid |
| Wichte | 0.991 |
| Farbe | Oil |
| Hauptanwendungen | genomic analysis |
| InChI | InChI=1S/C2H6N2O/c1-3-4(2)5/h1-2H3 |
| InChIKey | DGAKHGXRMXWHBX-UHFFFAOYSA-N |
| SMILES | [N+]([O-])(C)=NC |
| EPA chemische Informationen | Azoxymethane (25843-45-2) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | UN 1992 3/PG 3 |
| RTECS-Nr. | PA2975000 |
| R-Sätze (R) | 45-46-10-25-34-36/38 |
| Toxizität | mma-sat 13,600 mmol/L/20M CNREA8 38,4585,78 |
| Gefahrensymbole | T |
| Sicherheitshinweise (S) | 53-26-36/37/39-45 |
| Lagerklasse | 3 - Flammable liquids |
| Gefahrenklasse | Acute Tox. 2 OralCarc. 1BEye Irrit. 2Flam. Liq. 3Skin Irrit. 2 |
Anwendungen & Verwendung
Verwenden
Azoxymethane (AOM), a gene mutation agent, may be used with dextran sulfate sodium (DSS) to create cancer models in laboratory animals which can be used to study mechanisms of cancer progression and chemoprevention.