HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Fenoldopam
SKF-82526 · CS-1332 · Corlopam · FENOLDOPAM · SKF-82526-J · CORLOPAM MESYLATE · Fenoldopam, Corlopam · Fenoldopam USP/EP/BP
Identifikatoren & physikalische Daten
| CAS No. | 67227-56-9 |
|---|---|
| Summenformel | C16H16ClNO3 |
| Durchschnittliche Molmasse | 305,75 g/mol |
| Monoisotopische Masse | 305,08187105 g/mol |
| SMILES | Oc1ccc(C2CNCCc3c2cc(O)c(O)c3Cl)cc1 |
| InChIKey | TVURRHSHRRELCG-UHFFFAOYSA-N |
| PubChem CID | 3341 |
| ChEMBL | CHEMBL588 |
| ChEBI | CHEBI:5002 |
| DTXSID | DTXSID0043896 |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 72,7 |
| H-Brücken-Donoren | 4 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 348 |
| Arzneimittel | Pharmaceuticals |
| LogP (Verteilungskoeffizient) | 21.53 |
| Löslichkeit | 2.72e-01 g/LDMSO: >12 mg/mL |
| Human Drugs | Breast FeedingLactationMilk, HumanAntihypertensive AgentsDopamine AgentsDopamine AgonistsVasodilator AgentsPharmaceuticals |
| Physical Description | Solid |
| Siedepunkt | 522.6±50.0 °C(Predicted) |
| Dichte | 1.380±0.06 g/cm3(Predicted) |
| Lagerbedingungen | 2-8°C |
| pKa (Säurekonstante) | 8.50±0.40(Predicted) |
| Aggregatzustand | Powder |
| Farbe | off-white |
| InChI | InChI=1S/C16H16ClNO3/c17-15-11-5-6-18-8-13(9-1-3-10(19)4-2-9)12(11)7-14(20)16(15)21/h1-4,7,13,18-21H,5-6,8H2 |
| InChIKey | TVURRHSHRRELCG-UHFFFAOYSA-N |
| SMILES | N1CCC2=C(Cl)C(O)=C(O)C=C2C(C2=CC=C(O)C=C2)C1 |
| CAS Datenbank | 67227-56-9(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Drug Induced Liver Injury | Drug-Induced Liver Injury Severity and Toxicity (DILIst)fenoldopamDILI NegativeIntravenousDOI:10.1016/j.drudis.2019.09.022 |
|---|---|
| Effects During Pregnancy and Lactation | ◉ Summary of Use during Lactation |
| Wassergefährdungsklasse (WGK) | 3 |
| R-Sätze (R) | 22-36-42/43 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 22-26-36/37/39 |
Anwendungen & Verwendung
Verwenden
The dopamine receptors play important role in cognition, memory, learning, and motor control (1). These receptors have been implicated as a therapeutic target for many psychiatric and neurological disorders. Fenoldopam is a selective dopamine 1 receptor agonist with diuretic and properties (2,3).