HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 334855Erstellt: 27. Oktober 2026
2,6-Dichloro-4-methylnicotinamide
NSC 341976 · 2,6-chloro-4-methylamide · 2,6-Dichloro-4-methylnicotinamide · 2,6-DICHLORO-4-METHYL-3-PYRIDINECARBOXAMIDE · 3-PyridinecarboxaMide, 2,6-dichloro-4-Methyl-
https://huagongshe.com/de/chemical/334855
Identifikatoren & physikalische Daten
| CAS No. | 38841-54-2 |
|---|
| Summenformel | C7H6Cl2N2O |
|---|
| Durchschnittliche Molmasse | 205,04 g/mol |
|---|
| Monoisotopische Masse | 203,98571817 g/mol |
|---|
| SMILES | Cc1cc(Cl)nc(Cl)c1C(N)=O |
|---|
| InChIKey | FUHRWOFCZTZGQA-UHFFFAOYSA-N |
|---|
| PubChem CID | 334855 |
|---|
| EC No. | 609-589-4 |
|---|
| DTXSID | DTXSID70319217 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|
| Polarare Oberfläche (TPSA) | 56 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 12 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 188 |
|---|
| Schmelzpunkt | 170-171 °C(Solv: ethanol (64-17-5)) |
|---|
| Siedepunkt | 129-132/7mm |
|---|
| Dichte | 1.448 |
|---|
| Lagerbedingungen | 2-8°C |
|---|
| Aggregatzustand | crystalline solid |
|---|
| pKa (Säurekonstante) | 13.92±0.50(Predicted) |
|---|
| Farbe | White/off-white |
|---|
| InChI | InChI=1S/C7H6Cl2N2O/c1-3-2-4(8)11-6(9)5(3)7(10)12/h2H,1H3,(H2,10,12) |
|---|
| InChIKey | FUHRWOFCZTZGQA-UHFFFAOYSA-N |
|---|
| SMILES | C1(Cl)=NC(Cl)=CC(C)=C1C(N)=O |
|---|
| CAS Datenbank | 38841-54-2(CAS DataBase Reference) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P233, P260, P261, P264, P264+P265, P270, P271, P272, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P333+P317, P337+P317, P342+P316, P362+P364, P403, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Zollcode | 2933399990 |
|---|
| Gefahrensymbole | Xi |
|---|
| hazard_note | Irritant |
|---|
