HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,4-Dichlorpyridin
2,4-Dichlorpyridine · IFLAB-BB F2108-0071 · 2,4-DICHLOROPYRIDINE · Pyridine, 2,4-dichloro- · 2,4-Dichloropyridine>2,4 dicloropyridine 98% · 2,4-Dichloropyridine,97% · 2,4-Dichloropyridine 97% · 2,4-Dichloropyridine ,98%
Identifikatoren & physikalische Daten
| CAS No. | 26452-80-2 |
|---|---|
| Summenformel | C5H3Cl2N |
| Durchschnittliche Molmasse | 147,99 g/mol |
| Monoisotopische Masse | 146,96425446 g/mol |
| SMILES | Clc1ccnc(Cl)c1 |
| InChIKey | TYPVHTOETJVYIV-UHFFFAOYSA-N |
| PubChem CID | 33515 |
| EC No. | 247-717-7 |
| DTXSID | DTXSID20181047 |
| Lokaler Name | 2,4-Dichlorpyridin |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 12,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 76,8 |
| Schmelzpunkt | -1 °C |
| Siedepunkt | 189-190 °C (lit.) 76-78 °C/23 mmHg (lit.) |
| Dichte | 1.37 |
| Brechungsindex | 1.55-1.554 |
| Flammpunkt | 189-190°C |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| Löslichkeit | Chloroform |
| Aggregatzustand | Yellow to Pale Orange Liquid |
| pKa (Säurekonstante) | 0.12±0.10(Predicted) |
| Farbe | Colorless to Red to Green |
| BRN | 108666 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-2-8-5(7)3-4/h1-3H |
| InChIKey | TYPVHTOETJVYIV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Cl)=C1 |
| CAS Datenbank | 26452-80-2(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (93.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P262, P264, P264+P265, P270, P271, P272, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P333+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (93.8%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 2810 |
| Zollcode | 29333990 |
| RTECS-Nr. | NC3410400 |
| R-Sätze (R) | 25-38-41-43-36/37/38-20/22 |
| Gefahrensymbole | T,Xi,Xn |
| hazard_note | Harmful/Irritant |
| Sicherheitshinweise (S) | 26-36/37/39-45-36 |
| Gefahrenklasse | 6.1Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2Skin Sens. 1 |
| Verpackungsgruppe | III |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
2,4-Dichloropyridine is a versatile reactant used in the preparation of host materials for light-emitting diodes with heterocyclic cores. Also used in the preparation of sulfonylated pyridines, pyrazine and quinoline via aromatic nucleophilic substitution of azines with sodium sulfinates.