HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5-Fluor-2'-desoxyuridin
FUDR · FDUR · 5-FLUORODEOXYURIDINE · 5-FUDR · 5-Fluoro-1-((2R,4S,5R)-4-hydroxy-5-(hydroxyMethyl)tetrahydrofuran-2-yl)pyriMidine-2,4(1H,3H)-dione · 5-FLUORO-2-DEOXYURIDINE · 2'-Deoxy-5-fluorouridine · FUD
Identifikatoren & physikalische Daten
| CAS No. | 2968-28-7 |
|---|---|
| Summenformel | C9H11FN2O5 |
| Durchschnittliche Molmasse | 246,19 g/mol |
| Monoisotopische Masse | 246,06519967 g/mol |
| SMILES | O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1F |
| InChIKey | ODKNJVUHOIMIIZ-UHFFFAOYSA-N |
| PubChem CID | 3363 |
| ChEMBL | CHEMBL6628 |
| ChEBI | CHEBI:94445 |
| DTXSID | DTXSID70274397 |
| Lokaler Name | 5-Fluor-2'-desoxyuridin |
Chemische & physikalische Eigenschaften
| XLogP | -1,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 99,1 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 386 |
| Schmelzpunkt | 148 °C(lit.) |
| Siedepunkt | 150 °C |
| Dichte | 1.3751 (estimate) |
| Lagerbedingungen | room temp |
| Löslichkeit | Soluble to 100 mM in water and to 100 mM in DMSO |
| pKa (Säurekonstante) | pKa 7.44 (Uncertain) |
| Aggregatzustand | Powder |
| Farbe | White to almost white |
| Biologische Quelle | synthetic (organic) |
| Merck | 14,4112 |
| BRN | 2645818 |
| Stabilität | Stable. Incompatible with strong oxidizing agents. |
| Hauptanwendungen | pharmaceutical small molecule |
| InChI | 1S/C9H11FN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | ODKNJVUHOIMIIZ-GFCOJPQKSA-N |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N2C=C(F)C(=O)NC2=O |
| CAS Datenbank | 50-91-9(CAS DataBase Reference) |
| NIST chemische Informationen | Uridine, 2'-deoxy-5-fluoro-(50-91-9) |
| EPA chemische Informationen | Floxuridine (50-91-9) |
Sicherheit & Vorschriften
| F | 10-23 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2811 6.1/PG 3 |
| Zollcode | 29349990 |
| RTECS-Nr. | YU7525000 |
| R-Sätze (R) | 22-68-36/37/38-40-20/21/22 |
| Toxizität | LD50 oral in rat: 215mg/kg |
| Gefahrensymbole | Xn,T,Xi |
| hazard_note | Toxic |
| Sicherheitshinweise (S) | 22-36-36/37/39-26 |
| Gefahrenklasse | 6.1Acute Tox. 3 Oral |
| Verpackungsgruppe | III |
| Lagerklasse | 6.1D - Non-combustible acute toxic Cat.3toxic hazardous materials or hazardous materials causing chronic effects |
| Gefahrstoffdaten | 50-91-9(Hazardous Substances Data) |
Anwendungen & Verwendung
Verwenden
Floxuridine USP is used in Palliative treatment of gastrointestinal adenocarcinoma with liver metastases.