Identifikatoren & physikalische Daten
| CAS No. | 1801837-96-6 |
|---|
| Summenformel | C20H22O5 |
|---|
| Durchschnittliche Molmasse | 342,4 g/mol |
|---|
| Monoisotopische Masse | 342,1467238 g/mol |
|---|
| SMILES | CC(COC(=O)c1ccccc1)OC(C)COC(=O)c1ccccc1 |
|---|
| InChIKey | CGLQOIMEUPORRI-UHFFFAOYSA-N |
|---|
| PubChem CID | 33713 |
|---|
| EC No. | 998-529-3 |
|---|
| DTXSID | DTXSID801347215 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4 |
|---|
| Polarare Oberfläche (TPSA) | 61,8 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 10 |
|---|
| Schwere Atome | 25 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 372 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | H412 (100%): Harmful to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard]P273, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 37 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Aquatic Chronic 3 (100%) |
|---|
