HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Fluocinonid
fluocinolide · Fluocinolone Acetonide EP Impurity M · Vanos · Fluoxetine acetate · Fluocinonide Acetonide · (6α,11β,16α)-21-(Acetyloxy)-6,9-difluoro-11-hydroxy-16,17-[(1-Methylethylidene)bis(oxy)]pregna-1,4-diene-3,20-dione · Lidex · Lonide
Identifikatoren & physikalische Daten
| CAS No. | 356-12-7 |
|---|---|
| Summenformel | C26H32F2O7 |
| Durchschnittliche Molmasse | 494,5 g/mol |
| Monoisotopische Masse | 494,21160968 g/mol |
| SMILES | CC(=O)OCC(=O)C12OC(C)(C)OC1CC1C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC12C |
| InChIKey | WJOHZNCJWYWUJD-UHFFFAOYSA-N |
| PubChem CID | 3382 |
| Lokaler Name | Fluocinonid |
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 99,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 9 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 35 |
| Formalladung | 0 |
| Komplexität | 1.070 |
| Arzneimittel | Pharmaceuticals |
| Human Drugs | Breast FeedingLactationCorticosteroids, TopicalGlucocorticoidsAnti-Inflammatory Agents |
| Schmelzpunkt | 309 °C |
| Siedepunkt | 235°C (rough estimate) |
| Dichte | 1.2001 (estimate) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | DMSO: ≥19mg/mL0.53mg/L(25 ºC) |
| Aggregatzustand | powder |
| pKa (Säurekonstante) | 12.77±0.70(Predicted) |
| Farbe | white to tan |
| Hauptanwendungen | pharmaceutical (small molecule) |
| InChIKey | WJOHZNCJWYWUJD-IUGZLZTKSA-N |
| SMILES | [C@@]12(C(=O)COC(=O)C)OC(C)(C)O[C@@H]1C[C@@]1([H])[C@]3([H])C[C@@H](C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]21C)F |&1:0,13,15,17,20,27,29,31,34,r| |
Sicherheit & Vorschriften
| Effects During Pregnancy and Lactation | ◉ Summary of Use during Lactation |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2811 6.1/PG 2 |
| Zollcode | 2937220000 |
| RTECS-Nr. | TU3831000 |
| R-Sätze (R) | 28-63 |
| Toxizität | guinea pig,LD50,subcutaneous,> 3170mg/kg (3170mg/kg),Drugs in Japan Vol. 6, Pg. 694, 1982. |
| Gefahrensymbole | T+ |
| Sicherheitshinweise (S) | 22-25-28-36/37/39-45 |
| Gefahrenklasse | 6.1(a)Acute Tox. 2 OralRepr. 2 |
| Verpackungsgruppe | I |
| Lagerklasse | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
Anwendungen & Verwendung
Verwenden
Fluocinonide (Lidex, Lidex E, Fluonex) is a synthetic fluorinated corticosteroid.