HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Formoterol
Nicarbazin Impurity 10 · Formoterol Diastereoisomer · ForMoterol (Mixture of DiastereoMers) · Formamide, N-[2-hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]- · Formoterol Fumarate Dihydrate EP Impurity I/Formoterol USP RC I/Formoterol (mixture of Diastereomers)/N-[2-Hydroxy-5-[(1RS)-1-hydroxy-2-[[(1SR)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]formamide
Identifikatoren & physikalische Daten
| CAS No. | 128954-45-0 |
|---|---|
| Summenformel | C19H24N2O4 |
| Durchschnittliche Molmasse | 344,4 g/mol |
| Monoisotopische Masse | 344,17360725 g/mol |
| SMILES | COc1ccc(CC(C)NCC(O)c2ccc(O)c(NC=O)c2)cc1 |
| InChIKey | BPZSYCZIITTYBL-UHFFFAOYSA-N |
| PubChem CID | 3410 |
| ChEMBL | CHEMBL1256786 |
| ChEBI | CHEBI:63082 |
| EC No. | 615-991-0 |
| DTXSID | DTXSID20860603 |
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 90,8 |
| H-Brücken-Donoren | 4 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 8 |
| Schwere Atome | 25 |
| Formalladung | 0 |
| Komplexität | 388 |
| Schmelzpunkt | 66-69°C (dec.) |
| Siedepunkt | 603.2±55.0 °C(Predicted) |
| Dichte | 1.233±0.06 g/cm3(Predicted) |
| Lagerbedingungen | -20°C Freezer |
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 8.95±0.50(Predicted) |
| Farbe | Off-White to Light Brown |
Anwendungen & Verwendung
Verwenden
Formoterol is a selective β2-adrenergic receptor agonist. Formoterol is used as an antiasthmatic.