HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Fluoroisonicotinic acid
uoroisonicotinic Acid · 2-FluoroisonicotinicAci · 2-Fluoroisonotinic acid · 2-Fluoroisonictinic acid · 2-FLUOROISONICOTINIC ACID · 2-FluoroisonicotinicAcid>2-Fluoro-4-pyridinecorboxylc · 2-Fluoroisonicotinic acid ,98% · 2-Fluoro-4-pyridinecarboxlic acid
Identifikatoren & physikalische Daten
| CAS No. | 402-65-3 |
|---|---|
| Summenformel | C6H4FNO2 |
| Durchschnittliche Molmasse | 141,1 g/mol |
| Monoisotopische Masse | 141,02260659 g/mol |
| SMILES | O=C(O)c1ccnc(F)c1 |
| InChIKey | JMPFWDWYGOWUFP-UHFFFAOYSA-N |
| PubChem CID | 345360 |
| EC No. | 637-035-1 |
| DTXSID | DTXSID00323069 |
Chemische & physikalische Eigenschaften
| XLogP | 0,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 50,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 140 |
| Schmelzpunkt | 200 °C (dec.)(lit.) |
| Siedepunkt | 396.6±22.0 °C(Predicted) |
| Dichte | 1.419±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| pKa (Säurekonstante) | 3.03±0.10(Predicted) |
| Aggregatzustand | Powder |
| Farbe | White to Almost white |
| InChI | InChI=1S/C6H4FNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10) |
| InChIKey | JMPFWDWYGOWUFP-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=CC(C(O)=O)=C1 |
| CAS Datenbank | 402-65-3(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P280, P305+P351+P338, and P337+P317 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Eye Irrit. 2A (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29333990 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 22-24/25 |
| Gefahrenklasse | IRRITANT |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Fluoroisonicotinic acid is a catalyst in organic reactions and serves as a starting material for the synthesis of fluorinated compounds. Furthermore, it plays a role in the synthesis of dyes, pigments, and various other organic compounds.