HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 357739Erstellt: 25. Oktober 2026
(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-acetic acid butyl ester
https://huagongshe.com/de/chemical/357739
Identifikatoren & physikalische Daten
| CAS No. | 95750-89-3 |
|---|
| Summenformel | C14H15NO4 |
|---|
| Durchschnittliche Molmasse | 261,27 g/mol |
|---|
| SMILES | CCCCOC(=O)CN1C(=O)c2ccccc2C1=O |
|---|
| InChIKey | DDCPIBTYPYGETI-UHFFFAOYSA-N |
|---|
| PubChem CID | 357739 |
|---|
| ChEMBL | CHEMBL1981236 |
|---|
| EC No. | 163-253-7 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|
| Polarare Oberfläche (TPSA) | 63,7 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 6 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 356 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P273, P301+P316, P321, P330, P391, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
