HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-Bromo-2-methyl-1-propene
3-BROMO-2-METHYLPROP-1-ENE · 3-Bromo-2-methyl-1-propene · METHALLYL BROMIDE · METHYLALLYL BROMIDE · 2-(bromomethyl)prop-1-ene · 2-methylallylbromide · 3-Bromo-2-methyL · 2-(bromomethyl)propene
Identifikatoren & physikalische Daten
| CAS No. | 1458-98-6 |
|---|---|
| Summenformel | C4H7Br |
| Durchschnittliche Molmasse | 135 g/mol |
| Monoisotopische Masse | 133,97311232 g/mol |
| SMILES | C=C(C)CBr |
| InChIKey | USEGQJLHQSTGHW-UHFFFAOYSA-N |
| PubChem CID | 357785 |
| EC No. | 604-496-5 |
| DTXSID | DTXSID80326816 |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 5 |
| Formalladung | 0 |
| Komplexität | 38,9 |
| SpringerMaterials Properties | Schoenflies notation |
| Schmelzpunkt | -115.07°C (estimate) |
| Siedepunkt | 94-95 °C (lit.) |
| Dichte | 1.339 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.472(lit.) |
| Flammpunkt | 44 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Chloroform, Ethyl Acetate |
| Aggregatzustand | Oil |
| Farbe | Clear Colourless to Pale Yellow |
| Wichte | 1.339 |
| Stabilität | Light Sensitive |
| InChI | InChI=1S/C4H7Br/c1-4(2)3-5/h1,3H2,2H3 |
| InChIKey | USEGQJLHQSTGHW-UHFFFAOYSA-N |
| SMILES | C=C(C)CBr |
| CAS Datenbank | 1458-98-6(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P270, P271, P273, P280, P301+P317, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P317, P321, P330, P363, P370+P378, P391, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2924 3/PG 2 |
| Zollcode | 29033990 |
| R-Sätze (R) | 11-20/22-34-51/53 |
| Gefahrensymbole | F,C,N |
| Sicherheitshinweise (S) | 9-16-26-29-36/37/39-45-61 |
| Gefahrenklasse | 3.1Acute Tox. 4 InhalationAcute Tox. 4 OralAquatic Chronic 2Eye Dam. 1Flam. Liq. 2Skin Corr. 1B |
| Verpackungsgruppe | II |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
3-Bromo-2-methylpropene is used as a general reagent for various organic reactions and primarily for amino acid synthesis and asymmetric amino acid synthesis.