HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Thiocyclam-oxalat
san155 · Evisect · evisekt · san1551 · san155i · NERISECT · Sulfoxane · FICOLL(R)
Identifikatoren & physikalische Daten
| CAS No. | 31895-22-4 |
|---|---|
| Summenformel | C7H13NO4S3 |
| Durchschnittliche Molmasse | 271,4 g/mol |
| Monoisotopische Masse | 271,0006709 g/mol |
| SMILES | CN(C)C1CSSSC1.O=C(O)C(=O)O |
| InChIKey | ICTQUFQQEYSGGJ-UHFFFAOYSA-N |
| PubChem CID | 35969 |
| ChEMBL | CHEMBL2270412 |
| ChEBI | CHEBI:133553 |
| EC No. | 250-859-2 |
| DTXSID | DTXSID0047036 |
| Lokaler Name | Thiocyclam-oxalat |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 154 |
|---|---|
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 8 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 152 |
| Dampfdruck | 5.45 x 10-4 Pa (20 °C) |
| Flammpunkt | 130 °C |
| Lagerbedingungen | 0-6°C |
| pKa (Säurekonstante) | 3.95 (acid), 7.0 (base) |
| Löslichkeit | 16.3 g l-1(20 °C, pH 6.8) |
| BRN | 4771240 |
| Hauptanwendungen | agricultureenvironmental |
| InChI | 1S/C5H11NS3.C2H2O4/c1-6(2)5-3-7-9-8-4-53-1(4)2(5)6/h5H,3-4H2,1-2H3(H,3,4)(H,5,6) |
| InChIKey | ICTQUFQQEYSGGJ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(O)=O.CN(C)C1CSSSC1 |
| CAS Datenbank | 31895-22-4(CAS DataBase Reference) |
| EPA chemische Informationen | Thiocyclam hydrogen oxalate (31895-22-4) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302: Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P280, P301+P317, P302+P352, P317, P321, P330, P362+P364, P391, and P501 (click each P-code to see the statement)H302+H312 (40%): Harmful if swallowed or in contact with skin [Warning Acute toxicity, oralacute toxicity, dermal] |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.1%)Acute toxicity - category 4Acute Tox. 4 * |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 2588 |
| RTECS-Nr. | YL8300000 |
| R-Sätze (R) | 21/22-50/53 |
| Gefahrensymbole | Xn,N |
| Sicherheitshinweise (S) | 36/37-46-60-61 |
| Gefahrenklasse | 6.1(b)Acute Tox. 3 DermalAcute Tox. 3 OralAquatic Acute 1Aquatic Chronic 1 |
| Verpackungsgruppe | III |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
Thiocyclam is used to protect against Lepidoptera, Coleoptera, some Diptera and Thysanoptera. It is used to control Colorado beetle in potatoes, Lepidoptera and Coleoptera pest complexes in rape, stem borers in irrigated rice, corn borers and Tanymecus in maize, weevils and other Coleoptera in sugar beet, stem borers in sugar cane, Lepidoptera in fruit trees and leaf miners in vegetables.